ChemNet > CAS > 306936-84-5 4-[4-(benzyloxy)phenyl]-5-(2-furyl)-4H-1,2,4-triazole-3-thiol
306936-84-5 4-[4-(benzyloxy)phenyl]-5-(2-furyl)-4H-1,2,4-triazole-3-thiol
product Name |
4-[4-(benzyloxy)phenyl]-5-(2-furyl)-4H-1,2,4-triazole-3-thiol |
Synonyms |
4-[4-(benzyloxy)phenyl]-5-furan-2-yl-2,4-dihydro-3H-1,2,4-triazole-3-thione |
Molecular Formula |
C19H15N3O2S |
Molecular Weight |
349.4063 |
InChI |
InChI=1/C19H15N3O2S/c25-19-21-20-18(17-7-4-12-23-17)22(19)15-8-10-16(11-9-15)24-13-14-5-2-1-3-6-14/h1-12H,13H2,(H,21,25) |
CAS Registry Number |
306936-84-5 |
Molecular Structure |
|
Density |
1.31g/cm3 |
Melting point |
236℃ |
Boiling point |
498.6°C at 760 mmHg |
Refractive index |
1.675 |
Flash point |
255.4°C |
Vapour Pressur |
4.45E-10mmHg at 25°C |
Hazard Symbols |
|
Risk Codes |
|
Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|